16823-51-1
Chemical Structure
Reactive blue 5
- CAS No.: 16823-51-1
- Formula:C29H20ClN7O11S3
- Molecular Weight:774.16
IUPAC Name: 1-amino-4-((3-((4-chloro-6-((3-sulfophenyl)amino)-1,3,5-triazin-2-yl)amino)-4-sulfophenyl)amino)-9,10-dioxo-9,10-dihydroanthracene-2-sulfonic acid
InChIKey: NSDSIQGBHACTLY-UHFFFAOYSA-N
SMILES: O=S(C(C(N)=C1C2=O)=CC(NC3=CC=C(S(=O)(O)=O)C(NC4=NC(Cl)=NC(NC5=CC=CC(S(=O)(O)=O)=C5)=N4)=C3)=C1C(C6=C2C=CC=C6)=O)(O)=O
Biological Activity: Reactive blue 5 is common textile dyes that can be adsorbed onto single-walled carbon nanotubes (SWCNTs) through electrostatic interactions, allowing the separation of residual dyes.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Reactive blue 5 | Reactive blue 5 is common textile dyes that can be adsorbed onto single-walled carbon nanotubes (SWCNTs) through electrostatic interactions, allowing the separation of residual dyes. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||