172960-20-2
Chemical Structure
smMLCK peptide
Synonym(s): Smooth-Muscle Myosin Light-Chain Kinase (796-815)
- CAS No.: 172960-20-2
- Formula:C98H168N38O25
- Molecular Weight:2278.62
SMILES: C([C@H](NC([C@@H](NC([C@@H](NC([C@H](CCCNC(=N)N)NC([C@H](C)N)=O)=O)CCCNC(=N)N)=O)CCCCN)=O)C(N[C@H](C(N[C@H](C(N[C@H](C(NCC(N[C@@H](CC1=CN=CN1)C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(NCC(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(O)=O)CO)=O)CO)=O)CC(C)C)=O)CCCNC(=N)N)=O)=O)[C@H](CC)C)=O)C)=O)CCCNC(=N)N)=O)C(C)C)=O)C)=O)=O)=O)[C@@H](C)O)=O)CCCCN)=O)CCC(N)=O)=O)C=2C=3C(NC2)=CC=CC3
Biological Activity: smMLCK peptide is a specific inhibitor of smooth muscle myosin light chain kinase (smMLCK). The smMLCK peptide mimics the substrate and competitively inhibits the binding of the actual substrate to the enzyme, thereby inhibiting the kinase activity. This inhibition prevents the phosphorylation of the myosin light chain, thus inhibiting muscle contraction[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
smMLCK peptide | smMLCK peptide is a specific inhibitor of smooth muscle myosin light chain kinase (smMLCK). The smMLCK peptide mimics the substrate and competitively inhibits the binding of the actual substrate to the enzyme, thereby inhibiting the kinase activity. This inhibition prevents the phosphorylation of the myosin light chain, thus inhibiting muscle contraction. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
