173379-73-2
Chemical Structure
4’-Azido-2’-deoxy-2’-fluoro-beta-D-arabinouridine
- No. CAS: 173379-73-2
- Formula:C9H10FN5O5
- Molecular Weight:287.20
IUPAC Name: 1-((2R,3S,4R,5R)-5-azido-3-fluoro-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dione
InChIKey: SNWCOSVWPQSOEU-XZMZPDFPSA-N
SMILES: OC[C@]1(N=[N+]=[N-])[C@@H](O)[C@H](F)[C@H](N2C(NC(C=C2)=O)=O)O1
Biological Activity: 4’-Azido-2’-deoxy-2’-fluoro-beta-D-arabinouridine is a uridine analogue. Uridine has potential antiepileptic effects, and its analogs can be used to study anticonvulsant and anxiolytic activities, as well as to develop new antihypertensive agents[1]. 4’-Azido-2’-deoxy-2’-fluoro-beta-D-arabinouridine is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Referencia número | Nombre del producto | Pureza | Descripciòn | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
4’-Azido-2’-deoxy-2’-fluoro-beta-D-arabinouridine | 4’-Azido-2’-deoxy-2’-fluoro-beta-D-arabinouridine is a uridine analogue. Uridine has potential antiepileptic effects, and its analogs can be used to study anticonvulsant and anxiolytic activities, as well as to develop new antihypertensive agents. 4’-Azido-2’-deoxy-2’-fluoro-beta-D-arabinouridine is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
