1802907-93-2
Chemical Structure
Dde Biotin-PEG4-azide
- CAS No.: 1802907-93-2
- Formula:C32H53N7O8S
- Molecular Weight:695.87
IUPAC Name: N-(19-azido-15-(4,4-dimethyl-2,6-dioxocyclohexylidene)-3,6,9,12-tetraoxa-16-azanonadecyl)-5-((3aR,4R,6aS)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)pentanamide
InChIKey: HUAWNOKWZYCBQA-UCVANPEUSA-N
SMILES: O=C(NCCOCCOCCOCCOCC/C(NCCCN=[N+]=[N-])=C1C(CC(C)(C)CC\1=O)=O)CCCC[C@H]2SC[C@@]([C@@]2([H])N3)([H])NC3=O
Biological Activity: Dde Biotin-PEG4-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Dde Biotin-PEG4-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Dde Biotin-PEG4-azide | 99.44% | Dde Biotin-PEG4-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Dde Biotin-PEG4-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
