1884334-72-8
Chemical Structure
5-Azidomethyl-2’,3’,5’-tri-O-benzoyl uridine
- CAS No.: 1884334-72-8
- Formula:C31H25N5O9
- Molecular Weight:611.56
IUPAC Name: (2R,3R,4R,5R)-2-(5-(azidomethyl)-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-5-((benzoyloxy)methyl)tetrahydrofuran-3,4-diyl dibenzoate
InChIKey: LACRRSYIGKXACS-DLGLWYJGSA-N
SMILES: O=C(NC(C(CN=[N+]=[N-])=C1)=O)N1[C@@H]2O[C@H](COC(C3=CC=CC=C3)=O)[C@@H](OC(C4=CC=CC=C4)=O)[C@H]2OC(C5=CC=CC=C5)=O
Biological Activity: 5-Azidomethyl-2’,3’,5’-tri-O-benzoyl uridine is a thymidine analog. Analogs of this series have insertional activity towards replicated DNA. They can be used to label cells and track DNA synthesis[1]. 5-Azidomethyl-2’,3’,5’-tri-O-benzoyl uridine is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
5-Azidomethyl-2’,3’,5’-tri-O-benzoyl uridine | 5-Azidomethyl-2’,3’,5’-tri-O-benzoyl uridine is a thymidine analog. Analogs of this series have insertional activity towards replicated DNA. They can be used to label cells and track DNA synthesis. 5-Azidomethyl-2’,3’,5’-tri-O-benzoyl uridine is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
