19191-91-4
Chemical Structure
1,2-Dioctanoyl-sn-glycero-3-phosphocholine
- CAS No.: 19191-91-4
- Formula:C24H48NO8P
- Molecular Weight:509.61
IUPAC Name: (R)-2,3-bis(octanoyloxy)propyl (2-(trimethylammonio)ethyl) phosphate
InChIKey: YHIXRNNWDBPKPW-JOCHJYFZSA-N
SMILES: CCCCCCCC(OC[C@@H](OC(CCCCCCC)=O)COP(OCC[N+](C)(C)C)([O-])=O)=O
Biological Activity: 1,2-dioctanoyl-sn-glycero-3-phosphocholine, is a phospholipid commonly used as a component of liposome formulations and drug delivery systems. 1,2-dioctanoyl-sn-glycero-3-phosphocholine has unique chemical properties that allow it to form stable bilayers and vesicles, allowing drug encapsulation and delivery to specific targets in the body. It acts as a stabilizer and emulsifier, which can improve the solubility and bioavailability of drugs.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
1,2-Dioctanoyl-sn-glycero-3-phosphocholine | 99.86% | 1,2-dioctanoyl-sn-glycero-3-phosphocholine, is a phospholipid commonly used as a component of liposome formulations and drug delivery systems. 1,2-dioctanoyl-sn-glycero-3-phosphocholine has unique chemical properties that allow it to form stable bilayers and vesicles, allowing drug encapsulation and delivery to specific targets in the body. It acts as a stabilizer and emulsifier, which can improve the solubility and bioavailability of drugs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
