1988786-72-6
Chemical Structure
Lycibarbarphenylpropanoid B
- CAS No.: 1988786-72-6
- Formula:C21H28O13
- Molecular Weight:488.44
InChIKey: AQUUQTWLSPTGAA-JTLKKBGTSA-N
SMILES: OC[C@@H](O[C@H]([C@@H]([C@H]1O)O)OC(/C=C/C2=CC=C(C=C2)O)=O)[C@H]1O[C@@H]3O[C@@H]([C@H]([C@@H]([C@H]3O)O)O)CO
Biological Activity: Lycibarbarphenylpropanoid B is a phenylpropanoid compound derived from wolfberry with antioxidant activity. It exhibits significant oxygen radical absorbance capacity, with an ORAC value of 3.18 μmol Trolox/μmol (Trolox is a standard reference antioxidant, indicating that each μM of Lycibarbarphenylpropanoid B has antioxidant activity equivalent to 3.18 μM Trolox)[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Lycibarbarphenylpropanoid B | Lycibarbarphenylpropanoid B is a phenylpropanoid compound derived from wolfberry with antioxidant activity. It exhibits significant oxygen radical absorbance capacity, with an ORAC value of 3.18 μmol Trolox/μmol (Trolox is a standard reference antioxidant, indicating that each μM of Lycibarbarphenylpropanoid B has antioxidant activity equivalent to 3.18 μM Trolox). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
