1993176-74-1
Chemical Structure
N3-TOTA-Suc
- CAS No.: 1993176-74-1
- Formula:C14H26N4O6
- Molecular Weight:346.38
IUPAC Name: 1-azido-15-oxo-4,7,10-trioxa-14-azaoctadecan-18-oic acid
InChIKey: MXIOIMFVCMTCGP-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCCCOCCOCCOCCCNC(CCC(O)=O)=O
Biological Activity: N3-TOTA-Suc is a click chemistry reagent containing an azide group. Click chemistry is a powerful chemical reaction with excellent bioorthogonality features: biocompatible, rapid and highly specific in biological environments[1]. N3-TOTA-Suc is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N3-TOTA-Suc | N3-TOTA-Suc is a click chemistry reagent containing an azide group. Click chemistry is a powerful chemical reaction with excellent bioorthogonality features: biocompatible, rapid and highly specific in biological environments. N3-TOTA-Suc is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||