1998119-13-3
Chemical Structure
Cy7 alkyne chloride
- CAS No.: 1998119-13-3
- Formula:C40H48ClN3O
- Molecular Weight:622.28
IUPAC Name: 3,3-dimethyl-1-(6-oxo-6-(prop-2-yn-1-ylamino)hexyl)-2-((E)-2-((E)-3-(2-((Z)-1,3,3-trimethylindolin-2-ylidene)ethylidene)cyclohex-1-en-1-yl)vinyl)-3H-indol-1-ium chloride
InChIKey: YTVUOGKCIKICCK-UHFFFAOYSA-N
SMILES: C#CCNC(CCCCC[N+]1=C(/C=C/C2=C/C(CCC2)=C/C=C3N(C)C4=C(C=CC=C4)C\3(C)C)C(C)(C)C5=C1C=CC=C5)=O.[Cl-]
Biological Activity: Cy7 alkyne chloride is a dye derivative of Cyanine 7 (Cy7) containing an alkyne functional group (Ex/Em = 740/770 nm). The alkyne functionality of Cy7 alkyne chloride can react with molecules containing the azide functionality to form covalent bonds[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Cy7 alkyne chloride | Cy7 alkyne chloride is a dye derivative of Cyanine 7 (Cy7) containing an alkyne functional group (Ex/Em = 740/770 nm). The alkyne functionality of Cy7 alkyne chloride can react with molecules containing the azide functionality to form covalent bonds. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||