2055014-62-3
Chemical Structure
Azido-PEG8-PFP ester
- CAS No.: 2055014-62-3
- Formula:C25H36F5N3O10
- Molecular Weight:633.56
IUPAC Name: perfluorophenyl 1-azido-3,6,9,12,15,18,21,24-octaoxaheptacosan-27-oate
InChIKey: FLLXHBTXSPGUHL-UHFFFAOYSA-N
SMILES: O=C(OC1=C(F)C(F)=C(F)C(F)=C1F)CCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-]
Biological Activity: Azido-PEG8-PFP ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG8-PFP ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG8-PFP ester | 97.12% | Azido-PEG8-PFP ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG8-PFP ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
