207742-73-2
207742-73-2
Chemical Structure
O-Toluic acid-d7
Synonym(s): 2-Methylbenzoic acid-d7
- CAS No.: 207742-73-2
- Formula:C8HD7O2
- Molecular Weight:143.19
IUPAC Name: 2-(methyl-d3)benzoic-3,4,5,6-d4 acid
InChIKey: ZWLPBLYKEWSWPD-AAYPNNLASA-N
SMILES: OC(C1=C(C([2H])=C([2H])C([2H])=C1[2H])C([2H])([2H])[2H])=O
Biological Activity: O-Toluic acid-d7 is the deuterium labeled o-Toluic acid[1]. o-Toluic acid (2-Methylbenzoic acid) is a benzoic acid substituted by a methyl group at position 2. O-Toluic acid plays a role as a xenobiotic metabolite.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
O-Toluic acid-d7 | 99.53% | O-Toluic acid-d7 is the deuterium labeled o-Toluic acid. o-Toluic acid (2-Methylbenzoic acid) is a benzoic acid substituted by a methyl group at position 2. O-Toluic acid plays a role as a xenobiotic metabolite. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
o-Toluic acid (Standard) | ≥98% | o-Toluic acid (Standard) is the analytical standard of o-Toluic acid. This product is intended for research and analytical applications. o-Toluic acid (2-Methylbenzoic acid) is a benzoic acid substituted by a methyl group at position 2. O-Toluic acid plays a role as a xenobiotic metabolite. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
o-Toluic acid-13C | 99% | o-Toluic acid-13C is the 13C labeled o-Toluic acid. o-Toluic acid (2-Methylbenzoic acid) is a benzoic acid substituted by a methyl group at position 2. O-Toluic acid plays a role as a xenobiotic metabolite. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
o-Toluic acid | 99.77% | O-toluic acid (2-Methylbenzoic acid) is an organic compound that is benzoic acid with a methyl group substituted at the 2-position. O-toluic acid can act as an exogenous metabolite and holds some chemical research value. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
