2093152-79-3
Chemical Structure
N-(Azido-PEG4)-N-bis(PEG4-t-butyl ester)
- CAS No.: 2093152-79-3
- Formula:C40H78N4O16
- Molecular Weight:871.06
IUPAC Name: di-tert-butyl 16-(14-azido-3,6,9,12-tetraoxatetradecyl)-4,7,10,13,19,22,25,28-octaoxa-16-azahentriacontanedioate
InChIKey: SGDLRHGVQBJFAO-UHFFFAOYSA-N
SMILES: O=C(OC(C)(C)C)CCOCCOCCOCCOCCN(CCOCCOCCOCCOCCN=[N+]=[N-])CCOCCOCCOCCOCCC(OC(C)(C)C)=O
Biological Activity: N-(Azido-PEG4)-N-bis(PEG4-t-butyl ester) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. N-(Azido-PEG4)-N-bis(PEG4-t-butyl ester) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N-(Azido-PEG4)-N-bis(PEG4-t-butyl ester) | N-(Azido-PEG4)-N-bis(PEG4-t-butyl ester) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. N-(Azido-PEG4)-N-bis(PEG4-t-butyl ester) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
