2095417-18-6
Chemical Structure
3'-Azido-3'-deoxy-5-fluorocytidine
- CAS No.: 2095417-18-6
- Formula:C9H11FN6O4
- Molecular Weight:286.22
IUPAC Name: 4-amino-1-((2R,3R,4S,5S)-4-azido-3-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-5-fluoropyrimidin-2(1H)-one
InChIKey: MOEHIWUXKDQZBL-UAKXSSHOSA-N
SMILES: O[C@@H]1[C@H](N=[N+]=[N-])[C@@H](CO)O[C@H]1N2C=C(F)C(N)=NC2=O
Biological Activity: 3'-Azido-3'-deoxy-5-fluorocytidine (Compound 12) is a cytidine derivative. 3'-Azido-3'-deoxy-5-fluorocytidine is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
3'-Azido-3'-deoxy-5-fluorocytidine | 99.90% | 3'-Azido-3'-deoxy-5-fluorocytidine (Compound 12) is a cytidine derivative. 3'-Azido-3'-deoxy-5-fluorocytidine is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||