2100306-76-9
Chemical Structure
N-(Azido-PEG3)-N-Biotin-PEG4-methyl ester
- CAS No.: 2100306-76-9
- Formula:C30H54N6O11S
- Molecular Weight:706.85
IUPAC Name: methyl 1-azido-12-(5-((3aR,4R,6aS)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)pentanoyl)-3,6,9,15,18,21,24-heptaoxa-12-azaheptacosan-27-oate
InChIKey: ZZZFELOBFYPAJE-WWPJHQMMSA-N
SMILES: O=C(OC)CCOCCOCCOCCOCCN(C(CCCC[C@H]1SC[C@@]([C@@]1([H])N2)([H])NC2=O)=O)CCOCCOCCOCCN=[N+]=[N-]
Biological Activity: N-(Azido-PEG3)-N-Biotin-PEG4-methyl ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. N-(Azido-PEG3)-N-Biotin-PEG4-methyl ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N-(Azido-PEG3)-N-Biotin-PEG4-methyl ester | 95.0% | N-(Azido-PEG3)-N-Biotin-PEG4-methyl ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. N-(Azido-PEG3)-N-Biotin-PEG4-methyl ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
