2112731-95-8
Chemical Structure
N-(Azido-PEG3)-N-Boc-PEG4-acid
- CAS No.: 2112731-95-8
- Formula:C24H46N4O11
- Molecular Weight:566.64
IUPAC Name: 1-azido-12-(tert-butoxycarbonyl)-3,6,9,15,18,21,24-heptaoxa-12-azaheptacosan-27-oic acid
InChIKey: OADVJZWLSBSJIP-UHFFFAOYSA-N
SMILES: O=C(OC(C)(C)C)N(CCOCCOCCOCCN=[N+]=[N-])CCOCCOCCOCCOCCC(O)=O
Biological Activity: N-(Azido-PEG3)-N-Boc-PEG4-acid is a PEG-based PROTAC linker with a terminal azide group and is used in the synthesis of PROTACs[1] N-(Azido-PEG3)-N-Boc-PEG4-acid is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N-(Azido-PEG3)-N-Boc-PEG4-acid | N-(Azido-PEG3)-N-Boc-PEG4-acid is a PEG-based PROTAC linker with a terminal azide group and is used in the synthesis of PROTACs N-(Azido-PEG3)-N-Boc-PEG4-acid is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||