212370-40-6
Chemical Structure
Gp100 (25-33), human
Synonym(s): Hgp100 (25-33)
- CAS No.: 212370-40-6
- Formula:C52H82N16O14
- Molecular Weight:1155.31
IUPAC Name: L-lysyl-L-valyl-L-prolyl-L-arginyl-L-asparaginyl-L-glutaminyl-L-aspartyl-L-tryptophyl-L-leucine
InChIKey: BPGNBLOBUNIDNC-DYJKEWDMSA-N
SMILES: O=C(N[C@@H](C(C)C)C(N1[C@@H](CCC1)C(N[C@@H](CCCNC(N)=N)C(N[C@@H](CC(N)=O)C(N[C@@H](CCC(N)=O)C(N[C@@H](CC(O)=O)C(N[C@@H](CC2=CNC3=CC=CC=C23)C(N[C@@H](CC(C)C)C(O)=O)=O)=O)=O)=O)=O)=O)=O)[C@H](CCCCN)N
Biological Activity: Gp100 (25-33), human (Hgp100 (25-33)) is the amino acids 25-33 fragment of the human melanoma antigen. Gp100 (25-33), human is a 9-amino acid (AA) epitope restricted by MHC class I H-2Db and recognized by the T cells. Gp100 (25-33), human has immunogenicity and induces specific T cells. Gp100 (25-33), human can be used for the cancer research, such as melanoma[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Gp100 (25-33), human | 99.34% | Gp100 (25-33), human (Hgp100 (25-33)) is the amino acids 25-33 fragment of the human melanoma antigen. Gp100 (25-33), human is a 9-amino acid (AA) epitope restricted by MHC class I H-2Db and recognized by the T cells. Gp100 (25-33), human has immunogenicity and induces specific T cells. Gp100 (25-33), human can be used for the cancer research, such as melanoma. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
