2126831-23-8
Chemical Structure
Veldoreotide TFA
Synonym(s): DG3173 TFA; PTR-3173 TFA
- CAS No.: 2126831-23-8
- Formula:C62H75F3N12O12
- Molecular Weight:1237.33
InChIKey: KMXURQSBSDDSPX-NTYYTJCMSA-N
SMILES: O=C(N[C@@H](C(N[C@H](C(N[C@@](C(N[C@H](C1=O)CC2=CC=CC=C2)=O)([H])[C@H](O)C)=O)CCCCN)=O)CC3=CNC4=CC=CC=C34)[C@@H](NC([C@@H](NC(CCCNC(CCCN1CC(N)=O)=O)=O)CC5=CC=CC=C5)=O)CC6=CNC7=CC=CC=C67.OC(C(F)(F)F)=O
Biological Activity: Veldoreotide (DG3173) TFA a somatostatin analogue, binds to and activate the somatostatin receptors (SSTR) 2, 4, and 5. Veldoreotide TFA inhibits growth hormone (GH) secretion in adenomas compared with Octreotide (HY-P0036). Veldoreotide has the potential to be used as pain modulating agent[1]
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Veldoreotide TFA | 98.97% | Veldoreotide (DG3173) TFA a somatostatin analogue, binds to and activate the somatostatin receptors (SSTR) 2, 4, and 5. Veldoreotide TFA inhibits growth hormone (GH) secretion in adenomas compared with Octreotide (HY-P0036). Veldoreotide has the potential to be used as pain modulating agent | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||