22350-90-9
Chemical Structure
Altersolanol B
Synonym(s): Dactylarin
- CAS No.: 22350-90-9
- Formula:C16H16O6
- Molecular Weight:304.29
IUPAC Name: (2S,3R)-2,3,5-trihydroxy-7-methoxy-2-methyl-1,2,3,4-tetrahydroanthracene-9,10-dione
InChIKey: AAHQQIFXAQHGBD-WBMJQRKESA-N
SMILES: O=C1C2=C(O)C=C(OC)C=C2C(C3=C1C[C@H]([C@@](O)(C3)C)O)=O
Biological Activity: Altersolanol B (Dactylarin), a compound isolated from fungi, is structurally related to antibiotics and has been shown to induce ATP catabolism in Ehrlich ascites tumor cells.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Altersolanol B | Altersolanol B (Dactylarin), a compound isolated from fungi, is structurally related to antibiotics and has been shown to induce ATP catabolism in Ehrlich ascites tumor cells. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||