2252168-06-0
Chemical Structure
Pyrene azide 3
- CAS No.: 2252168-06-0
- Formula:C26H28N4O3
- Molecular Weight:444.53
IUPAC Name: N-(2-(2-(2-azidoethoxy)ethoxy)ethyl)-4-(pyren-1-yl)butanamide
InChIKey: DXXWPTFNJXUJQL-UHFFFAOYSA-N
SMILES: O=C(NCCOCCOCCN=[N+]=[N-])CCCC1=C(C2=C34)C=CC4=CC=CC3=CC=C2C=C1
Biological Activity: Pyrene azide 3 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Pyrene azide 3 is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Pyrene azide 3 | Pyrene azide 3 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Pyrene azide 3 is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
