2260670-44-6
Chemical Structure
18:1 DBCO PE ammonium
- CAS No.: 2260670-44-6
- Formula:C60H94N3O10P
- Molecular Weight:1048.38
InChIKey: BCRHDOMUBYTCLB-SJVKAYGHSA-N
SMILES: CCCCCCCC/C=C\CCCCCCCC(OC[C@@H](OC(CCCCCCC/C=C\CCCCCCCC)=O)COP(O)(OCCNC(CCC(N1CC2=CC=CC=C2C#CC3=CC=CC=C31)=O)=O)=O)=O.N
Biological Activity: 18:1 DBCO PE ammonium is a functionalized lipid that combines the biocompatible properties of phosphatidylethanolamine (PE) with the reactive dibenzocyclooctyne (DBCO) group. 18:1 DBCO PE ammonium is a click chemistry reagent, it contains a DBCO group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
18:1 DBCO PE ammonium | 18:1 DBCO PE ammonium is a functionalized lipid that combines the biocompatible properties of phosphatidylethanolamine (PE) with the reactive dibenzocyclooctyne (DBCO) group. 18:1 DBCO PE ammonium is a click chemistry reagent, it contains a DBCO group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||