2309360-05-0
Chemical Structure
Dodecyltrimethylammonium-d25 bromide
- CAS No.: 2309360-05-0
- Formula:C15H9D25BrN
- Molecular Weight:333.50
IUPAC Name: N,N,N-trimethyldodecan-1-aminium-d25 bromide
InChIKey: XJWSAJYUBXQQDR-MMHLDRISSA-M
SMILES: [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[N+](C)(C)C.[Br-]
Biological Activity: Dodecyltrimethylammonium-d25 (bromide) is the deuterium labeled Dodecyltrimethylammonium (bromide)[1]. Dodecyltrimethylammonium bromide (DTAB) is a surfactant. Dodecyltrimethylammonium bromide interacts with DNA and changes the mechanical properties of DNA on binding and the specific binding parameters of the interaction[2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Dodecyltrimethylammonium-d25 bromide | Dodecyltrimethylammonium-d25 (bromide) is the deuterium labeled Dodecyltrimethylammonium (bromide). Dodecyltrimethylammonium bromide (DTAB) is a surfactant. Dodecyltrimethylammonium bromide interacts with DNA and changes the mechanical properties of DNA on binding and the specific binding parameters of the interaction. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Dodecyltrimethylammonium-d34 bromide | Dodecyltrimethylammonium-d34 (bromide) is the deuterium labeled Dodecyltrimethylammonium (bromide). Dodecyltrimethylammonium bromide (DTAB) is a surfactant. Dodecyltrimethylammonium bromide interacts with DNA and changes the mechanical properties of DNA on binding and the specific binding parameters of the interaction. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Dodecyltrimethylammonium-d9 bromide | Dodecyltrimethylammonium-d9 bromide is the deuterium labeled Dodecyltrimethylammonium bromide (HY-D0838). Dodecyltrimethylammonium bromide (DTAB) is a surfactant. Dodecyltrimethylammonium bromide interacts with DNA and changes the mechanical properties of DNA on binding and the specific binding parameters of the interaction. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Dodecyltrimethylammonium bromide | 99.97% | Dodecyltrimethylammonium bromide (DTAB) is a surfactant. Dodecyltrimethylammonium bromide interacts with DNA and changes the mechanical properties of DNA on binding and the specific binding parameters of the interaction. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
- [1]. Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019 Feb;53(2):211-216. [Content Brief]
- [2]. E F Silva, et al. Dodecyltrimethylammonium bromide surfactant effects on DNA: Unraveling the competition between electrostatic and hydrophobic interactions. [Content Brief]
