2353409-48-8
Chemical Structure
TCO-PEG2-Sulfo-NHS ester-EDC Urea
- CAS No.: 2353409-48-8
- Formula:C28H49N5O12S
- Molecular Weight:679.78
IUPAC Name: 1-(3-(dimethylamino)propyl)-3-ethylurea (Z)-1-((3-(2-(2-(((cyclooct-4-en-1-yloxy)carbonyl)amino)ethoxy)ethoxy)propanoyl)oxy)-2,5-dioxopyrrolidine-3-sulfonate
InChIKey: YNSGTSDZEFXCER-ODZAUARKSA-N
SMILES: O=C(NCCOCCOCCC(ON1C(CC(S(=O)(O)=O)C1=O)=O)=O)OC2CC/C=C\CCC2.O=C(NCCCN(C)C)NCC
Biological Activity: TCO-PEG2-Sulfo-NHS ester-EDC Urea is a click chemistry reagent containing an azide group. TCO-PEG2-Sulfo-NHS ester is a PEG linker containing a TCO moiety and a sulfo-NHS ester moiety. The sulfo group makes this molecule soluble in waqueous buffer. This reagent can be used to label antibodies, proteins and other primary amine-containing macromolecules with TCO moiety. Reagent grade, for research use only[1]. TCO-PEG2-Sulfo-NHS ester-EDC Urea is a click chemistry reagent, it contains a TCO group that can undergo an inverse electron demand Diels-Alder reaction (iEDDA) with molecules containing Tetrazine groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
TCO-PEG2-Sulfo-NHS ester-EDC Urea | TCO-PEG2-Sulfo-NHS ester-EDC Urea is a click chemistry reagent containing an azide group. TCO-PEG2-Sulfo-NHS ester is a PEG linker containing a TCO moiety and a sulfo-NHS ester moiety. The sulfo group makes this molecule soluble in waqueous buffer. This reagent can be used to label antibodies, proteins and other primary amine-containing macromolecules with TCO moiety. Reagent grade, for research use only. TCO-PEG2-Sulfo-NHS ester-EDC Urea is a click chemistry reagent, it contains a TCO group that can undergo an inverse electron demand Diels-Alder reaction (iEDDA) with molecules containing Tetrazine groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
