23868-34-0
Chemical Structure
Tetrabutylammonium hydrogen difluoride
- CAS No.: 23868-34-0
- Formula:C16H37F2N
- Molecular Weight:281.47
InChIKey: FVECGKAXWOHLGP-UHFFFAOYSA-N
SMILES: CCCC[N+](CCCC)(CCCC)CCCC.[F-][H+][F-]
Biological Activity: Tetrabutylammonium (hydrogen difluoride) is a quaternary ammonium salt containing fluoride ions. It is a highly active and effective reagent, often used in organic synthesis reactions, especially for the modification of organic molecules with fluorine atoms. Tetrabutylammonium (hydrogen difluoride) is also used as a catalyst for various chemical reactions such as esterification and transesterification. Additionally, it is used in the production of specialty chemicals such as surfactants and detergents.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Tetrabutylammonium hydrogen difluoride | Tetrabutylammonium (hydrogen difluoride) is a quaternary ammonium salt containing fluoride ions. It is a highly active and effective reagent, often used in organic synthesis reactions, especially for the modification of organic molecules with fluorine atoms. Tetrabutylammonium (hydrogen difluoride) is also used as a catalyst for various chemical reactions such as esterification and transesterification. Additionally, it is used in the production of specialty chemicals such as surfactants and detergents. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
