245660-13-3
Chemical Structure
EpoY
Synonym(s): SD-142
- CAS No.: 245660-13-3
- Formula:C15H17NO7
- Molecular Weight:323.30
IUPAC Name: ((2S,3S)-3-(ethoxycarbonyl)oxirane-2-carbonyl)-L-tyrosine
InChIKey: PSLWNPKMALERSK-SRVKXCTJSA-N
SMILES: OC(C=C1)=CC=C1C[C@@H](C(O)=O)NC([C@@H]2[C@H](O2)C(OCC)=O)=O
Biological Activity: EpoY (SD-142) acts as an irreversible inhibitor of the brain's primary tubulin tyrosine carboxypeptidase (TCP), a complex formed by vasohibin-1 (VASH1) and the small vasohibin binding protein (SVBP). By inhibiting TCP with an IC50 value of approximately 500 nM, EpoY effectively decreases levels of detyrosinated alpha-tubulin, which is crucial for microtubule dynamics and neuronal differentiation. This inhibition leads to significant differentiation defects and has been linked to underlying issues associated with cancer and cardiomyopathies.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
EpoY | 98.0% | EpoY (SD-142) acts as an irreversible inhibitor of the brain's primary tubulin tyrosine carboxypeptidase (TCP), a complex formed by vasohibin-1 (VASH1) and the small vasohibin binding protein (SVBP). By inhibiting TCP with an IC50 value of approximately 500 nM, EpoY effectively decreases levels of detyrosinated alpha-tubulin, which is crucial for microtubule dynamics and neuronal differentiation. This inhibition leads to significant differentiation defects and has been linked to underlying issues associated with cancer and cardiomyopathies. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
