2481744-33-4
Chemical Structure
CaMKIIα-PHOTAC
- CAS No.: 2481744-33-4
- Formula:C54H58Cl2N10O11
- Molecular Weight:1094.00
InChIKey: RDVVUBKXCBWLMZ-DYJPEZSASA-N
SMILES: O=C(COC1=C(OC)C=C(/N=N/C2=CC=CC3=C2CN(C(CC4)C(NC4=O)=O)C3=O)C=C1OC)NCCCCCC(N5CCN(CCCOC6=C(OC)C=C7C(NC8=CC(OC)=C(Cl)C=C8Cl)=C(C#N)C=NC7=C6)CC5)=O
Biological Activity: CaMKIIα-PHOTAC is a photochemically targeted chimera (PHOTAC) targeting Ca2+/calmodulin-dependent protein kinase II α (CaMKIIα). Molecules such as PHOTAC can catalyze the ubiquitination and degradation of target proteins through the endogenous proteasome under specific wavelengths of light. CaMKIIα-PHOTAC reduces synaptic function under light conditions, and it attenuates the intensity of evoked field excitatory postsynaptic potentials in the mouse hippocampus in response to physiological stimuli. CaMKIIα-PHOTAC plays a critical role in maintaining long-term potentiation and memory capacity in subcellular dendritic domains[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
CaMKIIα-PHOTAC | CaMKIIα-PHOTAC is a photochemically targeted chimera (PHOTAC) targeting Ca2+/calmodulin-dependent protein kinase II α (CaMKIIα). Molecules such as PHOTAC can catalyze the ubiquitination and degradation of target proteins through the endogenous proteasome under specific wavelengths of light. CaMKIIα-PHOTAC reduces synaptic function under light conditions, and it attenuates the intensity of evoked field excitatory postsynaptic potentials in the mouse hippocampus in response to physiological stimuli. CaMKIIα-PHOTAC plays a critical role in maintaining long-term potentiation and memory capacity in subcellular dendritic domains. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
