25348-63-4
Chemical Structure
Conduritol B tetraacetate
- CAS No.: 25348-63-4
- Formula:C14H18O8
- Molecular Weight:314.29
InChIKey: REXNPDYWUANMIX-IGQOVBAYSA-N
SMILES: CC(O[C@H]1[C@@H]([C@H](C=C[C@@H]1OC(C)=O)OC(C)=O)OC(C)=O)=O
Biological Activity: Conduritol B tetraacetate is a class of biochemical reagents used in glycobiology research. Glycobiology studies the structure, synthesis, biology, and evolution of sugars. It involves carbohydrate chemistry, enzymology of glycan formation and degradation, protein-glycan recognition, and the role of glycans in biological systems. This field is closely related to basic research, biomedicine, and biotechnology[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Conduritol B tetraacetate | Conduritol B tetraacetate is a class of biochemical reagents used in glycobiology research. Glycobiology studies the structure, synthesis, biology, and evolution of sugars. It involves carbohydrate chemistry, enzymology of glycan formation and degradation, protein-glycan recognition, and the role of glycans in biological systems. This field is closely related to basic research, biomedicine, and biotechnology. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||