2538-85-4
Chemical Structure
Mordant black 17
Synonym(s): Sunchromine blue black R
- CAS No.: 2538-85-4
- Formula:C20H13N2NaO5S
- Molecular Weight:416.38
IUPAC Name: sodium (E)-3-hydroxy-4-((2-hydroxynaphthalen-1-yl)diazenyl)naphthalene-1-sulfonate
InChIKey: ZQWICJYATMSSSD-QUABFQRHSA-M
SMILES: O=S(C1=CC(O)=C(C2=C1C=CC=C2)/N=N/C3=C(C=CC4=C3C=CC=C4)O)(O[Na])=O
Biological Activity: Mordant black 17 (Sunchromine blue black R) is a versatile chelating agent, demonstrating significant adsorptive properties through its interaction with metal ions, enhancing the efficiency of polymeric materials in various applications.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Mordant black 17 | Mordant black 17 (Sunchromine blue black R) is a versatile chelating agent, demonstrating significant adsorptive properties through its interaction with metal ions, enhancing the efficiency of polymeric materials in various applications. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||