2555045-67-3
Chemical Structure
Phototherapeutic agent-1
- CAS No.: 2555045-67-3
- Formula:C39H33F6N2O2PS3
- Molecular Weight:802.85
IUPAC Name: (E)-2-(2-(5'-(4-(bis(4-methoxyphenyl)amino)phenyl)-[2,2'-bithiophen]-5-yl)vinyl)-3-ethylbenzo[d]thiazol-3-ium hexafluorophosphate(V)
InChIKey: ZEIYXGUJQQAMHW-UHFFFAOYSA-N
SMILES: [F-][P+5]([F-])([F-])([F-])([F-])[F-].CC[N+](C1=CC=CC=C1S2)=C2/C=C/C3=CC=C(S3)C4=CC=C(S4)C(C=C5)=CC=C5N(C6=CC=C(C=C6)OC)C7=CC=C(C=C7)OC
Biological Activity: Phototherapeutic agent-1 is a multi-modal light diagnosis agent with aggregation-induced emission properties. have certain Phototherapeutic agent-1 has certain reactive oxygen species (ROS) generation capacity in illumination condition. Phototherapeutic agent-1 can effectively kill cancer cells and tumor tissue[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Phototherapeutic agent-1 | Phototherapeutic agent-1 is a multi-modal light diagnosis agent with aggregation-induced emission properties. have certain Phototherapeutic agent-1 has certain reactive oxygen species (ROS) generation capacity in illumination condition. Phototherapeutic agent-1 can effectively kill cancer cells and tumor tissue. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
