2567584-97-6
Chemical Structure
Azido-PEG11-CH2COOH
- CAS No.: 2567584-97-6
- Formula:C24H47N3O13
- Molecular Weight:585.64
IUPAC Name: 35-azido-3,6,9,12,15,18,21,24,27,30,33-undecaoxapentatriacontanoic acid
InChIKey: XLUHQICXMSKVSO-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCC(O)=O
Biological Activity: Azido-PEG11-CH2COOH is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG11-CH2COOH is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG11-CH2COOH | Azido-PEG11-CH2COOH is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG11-CH2COOH is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||