25899-70-1
Chemical Structure
Xanthosine 5'-monophosphate sodium salt
Synonym(s): 5'-Xanthylic acid sodium salt
- CAS No.: 25899-70-1
- Formula:C10H11N4Na2O9P
- Molecular Weight:408.17
IUPAC Name: sodium ((2R,3S,4R,5R)-5-(2,6-dihydroxy-9H-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-yl)methyl phosphate
InChIKey: QQPVYRBCIRHGSZ-LGVAUZIVSA-L
SMILES: O=C1C2=C(N([C@H]3[C@H](O)[C@H](O)[C@@H](COP(O[Na])(O[Na])=O)O3)C=N2)NC(N1)=O
Biological Activity: Xanthosine 5'-monophosphate sodium salt (5'-Xanthylic acid sodium salt) is an intermediate in purine metabolism. Xanthosine 5'-monophosphate sodium salt can be used for genetic code, nucleic acid structure, and DNA, RNA and protein synthesis research[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Xanthosine 5'-monophosphate sodium salt | 99.61% | Xanthosine 5'-monophosphate sodium salt (5'-Xanthylic acid sodium salt) is an intermediate in purine metabolism. Xanthosine 5'-monophosphate sodium salt can be used for genetic code, nucleic acid structure, and DNA, RNA and protein synthesis research. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||