2755573-20-5
Chemical Structure
DBCO-PEG3-TCO
- CAS No.: 2755573-20-5
- Formula:C36H45N3O7
- Molecular Weight:631.76
InChIKey: OYEIJQBQBCHZLD-XIASJIJZSA-N
SMILES: O=C(N1C2=CC=CC=C2C#CC3=CC=CC=C3C1)CCC(NCCOCCOCCOCCNC(OC4CCC/C=C/CC4)=O)=O
Biological Activity: DBCO-PEG3-TCO is a non-cleavable 3 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. DBCO-PEG3-TCO is a click chemistry reagent, it contains a DBCO group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups. DBCO-PEG3-TCO also contains a TCO group that can undergo an inverse electron demand Diels-Alder reaction (iEDDA) with molecules containing Tetrazine groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
DBCO-PEG3-TCO | 98.0% | DBCO-PEG3-TCO is a non-cleavable 3 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). DBCO-PEG3-TCO is a click chemistry reagent, it contains a DBCO group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups. DBCO-PEG3-TCO also contains a TCO group that can undergo an inverse electron demand Diels-Alder reaction (iEDDA) with molecules containing Tetrazine groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||