2760599-02-6
Chemical Structure
Sulfo-Cy7.5 carboxylic acid
- CAS No.: 2760599-02-6
- Formula:C45H45K3N2O14S4
- Molecular Weight:1083.40
InChIKey: PXONAKGPEHLATG-UHFFFAOYSA-K
SMILES: CC(C1=C(N/2C)C=CC3=C1C=C(S(=O)(O[K])=O)C=C3S(=O)(O[K])=O)(C)C2=C/C=C4CCCC(/C=C/C5=[N+](CCCCCC(O)=O)C(C=CC6=C7C=C(S(=O)(O[K])=O)C=C6S([O-])(=O)=O)=C7C5(C)C)=C\4
Biological Activity: Sulfo-Cy7.5 carboxylic acid is a dye derivative of Cyanine 7.5 (Cy7.5) (HY-D0926) with carboxylic acid and sulfonate ion (sulfonate) functional groups. The sulfonate ion increases the water solubility of the compound, making it suitable for use in aqueous solutions. Cy7.5 is a near-infrared fluorescent dye commonly used in biomedical research areas such as biomarkers and cell imaging. Sulfo-Cy7.5 carboxylic acid can be covalently bound to some biomolecules (especially antibodies, proteins, etc.) to track their location and dynamic changes in biological samples.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Sulfo-Cy7.5 carboxylic acid | Sulfo-Cy7.5 carboxylic acid is a dye derivative of Cyanine 7.5 (Cy7.5) (HY-D0926) with carboxylic acid and sulfonate ion (sulfonate) functional groups. The sulfonate ion increases the water solubility of the compound, making it suitable for use in aqueous solutions. Cy7.5 is a near-infrared fluorescent dye commonly used in biomedical research areas such as biomarkers and cell imaging. Sulfo-Cy7.5 carboxylic acid can be covalently bound to some biomolecules (especially antibodies, proteins, etc.) to track their location and dynamic changes in biological samples. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||