3061726-02-8
Chemical Structure
Azido-PEG35-alcohol
Synonym(s): Azido-PEG35-acid
- CAS No.: 3061726-02-8
- Formula:C70H141N3O35
- Molecular Weight:1584.87
InChIKey: RQUBXWCYZHOKRB-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO
Biological Activity: Azido-PEG35-alcohol (Azido-PEG35-acid) is a PEG derivative that can be used for drug delivery and other research. Azido-PEG35-alcohol is a click chemistry reagent. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing an alkyne group. It can also undergo ring strain driven alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG35-alcohol | Azido-PEG35-alcohol (Azido-PEG35-acid) is a PEG derivative that can be used for drug delivery and other research. Azido-PEG35-alcohol is a click chemistry reagent. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing an alkyne group. It can also undergo ring strain driven alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||