3075220-94-6
Chemical Structure
Azido-PEG24-Tos
- CAS No.: 3075220-94-6
- Formula:C55H103N3O26S
- Molecular Weight:1254.48
InChIKey: JRBBQVLNNWQYTF-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOS(=O)(C1=CC=C(C=C1)C)=O
Biological Activity: Azido-PEG24-Tos is a PEG derivative that can be used for drug delivery and other research. Azido-PEG24-Tos is a click chemistry reagent. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing an alkyne group. It can also undergo ring strain driven alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG24-Tos | Azido-PEG24-Tos is a PEG derivative that can be used for drug delivery and other research. Azido-PEG24-Tos is a click chemistry reagent. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing an alkyne group. It can also undergo ring strain driven alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||