3091879-88-5
3091879-88-5
Chemical Structure
Meso-Cl cyanine 7.5 free acid chloride
- CAS No.: 3091879-88-5
- Formula:C45H48Cl2N2O2
- Molecular Weight:719.78
SMILES: O=C(CCCCCN1C2=C(C(C)(C)/C1=C\C=C3C(Cl)=C(CCC\3)/C=C/C4=[N+](C)C5=C(C4(C)C)C6=C(C=CC=C6)C=C5)C7=C(C=CC=C7)C=C2)O.[Cl-]
Biological Activity: Meso-Cl cyanine 7.5 free acid chloride is a Meso-Cl cyanine fluorescent dye. Meso-Cl cyanine 7.5 free acid chloride can be used for labelling amine groups such as those on antibodies, nucleic acids, and proteins and can be detected using a variety of fluorescence detection techniques such as microscopy and flow cytometry (Ex/Em = 815/825 nm)[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Meso-Cl cyanine 7.5 free acid chloride | Meso-Cl cyanine 7.5 free acid chloride is a Meso-Cl cyanine fluorescent dye. Meso-Cl cyanine 7.5 free acid chloride can be used for labelling amine groups such as those on antibodies, nucleic acids, and proteins and can be detected using a variety of fluorescence detection techniques such as microscopy and flow cytometry (Ex/Em = 815/825 nm). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
