3256-24-4
Chemical Structure
Uridylyl-(3′→5′)-adenosine
Synonym(s): UpA
- CAS No.: 3256-24-4
- Formula:C19H24N7O12P
- Molecular Weight:573.41
InChIKey: SWTWQWKNQDDGCS-KPKSGTNCSA-N
SMILES: O[C@@H]1[C@H](OP(OC[C@H]2O[C@@H](N3C4=NC=NC(N)=C4N=C3)[C@H](O)[C@@H]2O)(O)=O)[C@@H](CO)O[C@H]1N5C(NC(C=C5)=O)=O
Biological Activity: Uridylyl-(3′→5′)-adenosine (UpA) is a dinucleotide, which is composed of a unrail base and an adenosine suger molecule through a 3'-5' phosphodiester bond. Uridylyl-(3′→5′)-adenosine participates in the biological processes, such as gene expression regulation, signal transduction, and protein synthesis[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Uridylyl-(3′→5′)-adenosine | Uridylyl-(3′→5′)-adenosine (UpA) is a dinucleotide, which is composed of a unrail base and an adenosine suger molecule through a 3'-5' phosphodiester bond. Uridylyl-(3′→5′)-adenosine participates in the biological processes, such as gene expression regulation, signal transduction, and protein synthesis. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||