363610-32-6
Chemical Structure
Oxyphyllenodiol B
- CAS No.: 363610-32-6
- Formula:C14H22O3
- Molecular Weight:238.32
InChIKey: SZSSWPDHIZIMCT-BIGNPOOSSA-N
SMILES: CC([C@@H]1C2=C(CC[C@@](O)([C@H]2O)C)C(CC1)=O)C
Biological Activity: Oxyphyllenodiol B is an eremophilane-type sesquiterpene compound that can be isolated from the fruits of Alpinia oxyphylla. Oxyphyllenodiol B exerts potential anti-inflammatory activity by inhibiting nitric oxide (NO) production. Alpinia oxyphylla is generally known for its effects against diarrhea and dementia[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Oxyphyllenodiol B | Oxyphyllenodiol B is an eremophilane-type sesquiterpene compound that can be isolated from the fruits of Alpinia oxyphylla. Oxyphyllenodiol B exerts potential anti-inflammatory activity by inhibiting nitric oxide (NO) production. Alpinia oxyphylla is generally known for its effects against diarrhea and dementia. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||