3648-21-3
Chemical Structure
Diheptyl phthalate
- CAS No.: 3648-21-3
- Formula:C22H34O4
- Molecular Weight:362.51
IUPAC Name: diheptyl phthalate
InChIKey: JQCXWCOOWVGKMT-UHFFFAOYSA-N
SMILES: O=C(OCCCCCCC)C1=CC=CC=C1C(OCCCCCCC)=O
Biological Activity: Diheptyl phthalate is a class of phthalates consisting of two heptyl (C7) chains attached to a phthalic acid backbone. This compound is commonly used as a plasticizer in various polymer materials such as PVC to increase flexibility and durability. It can also be used as a lubricant, solvent or additive in various industrial applications such as coatings, adhesives and sealants. However, Diheptyl phthalate has been identified as an environmental pollutant and health hazard due to its potential for endocrine disruption and toxicity.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Diheptyl phthalate | 98.64% | Diheptyl phthalate is a class of phthalates consisting of two heptyl (C7) chains attached to a phthalic acid backbone. This compound is commonly used as a plasticizer in various polymer materials such as PVC to increase flexibility and durability. It can also be used as a lubricant, solvent or additive in various industrial applications such as coatings, adhesives and sealants. However, Diheptyl phthalate has been identified as an environmental pollutant and health hazard due to its potential for endocrine disruption and toxicity. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Diheptyl phthalate-d4 | Diheptyl phthalate-d4 is the deuterium labeled Diheptyl phthalate. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||