368434-78-0
Chemical Structure
PB01
- CAS No.: 368434-78-0
- Formula:C18H21N5O3
- Molecular Weight:355.39
SMILES: O=C1C2=C(N(C)C(N1C)=O)N=C(N3CCOCC3)N2CC4=CC=CC=C4
Biological Activity: PB01 is a DPP-4 inhibitor with an IC50 of 15.66 nM. It effectively inhibits high glucose-induced ROS production and mitochondrial superoxide formation while significantly reducing cellular DPP-4 expression. PB01 can also significantly lower blood glucose levels in diabetic mice. Additionally, PB01 demonstrates good safety, exhibiting almost no cytotoxicity at a concentration of 100 μM. PB01 holds potential for research in the field of diabetes[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
PB01 | PB01 is a DPP-4 inhibitor with an IC50 of 15.66 nM. It effectively inhibits high glucose-induced ROS production and mitochondrial superoxide formation while significantly reducing cellular DPP-4 expression. PB01 can also significantly lower blood glucose levels in diabetic mice. Additionally, PB01 demonstrates good safety, exhibiting almost no cytotoxicity at a concentration of 100 μM. PB01 holds potential for research in the field of diabetes. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||