37805-90-6
Chemical Structure
5-Methoxy cytidine
- CAS No.: 37805-90-6
- Formula:C10H15N3O6
- Molecular Weight:273.24
IUPAC Name: 4-amino-1-((2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-5-methoxypyrimidin-2(1H)-one
InChIKey: IZFJAICCKKWWNM-JXOAFFINSA-N
SMILES: OC[C@@H]1[C@@H](O)[C@@H](O)[C@H](N2C(N=C(N)C(OC)=C2)=O)O1
Biological Activity: 5-Methoxy cytidine is a cytidine analog. Cytidine analogs have a mechanism of inhibiting DNA methyltransferases (such as Zebularine, HY-13420), and have potential anti-metabolic and anti-tumor activities[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
5-Methoxy cytidine | 5-Methoxy cytidine is a cytidine analog. Cytidine analogs have a mechanism of inhibiting DNA methyltransferases (such as Zebularine, HY-13420), and have potential anti-metabolic and anti-tumor activities. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||