41945-43-1
Chemical Structure
Naproxen glucuronide
Synonym(s): (S)-Naproxen-β-D-glucuronide
- CAS No.: 41945-43-1
- Formula:C20H22O9
- Molecular Weight:406.38
IUPAC Name: (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(((S)-2-(6-methoxynaphthalen-2-yl)propanoyl)oxy)tetrahydro-2H-pyran-2-carboxylic acid
InChIKey: XRHIELLXTVJOKM-ODXKUVGNSA-N
SMILES: OC([C@H]([C@H]([C@@H]([C@H]1O)O)O)O[C@H]1OC([C@H](C2=CC3=C(C=C2)C=C(C=C3)OC)C)=O)=O
Biological Activity: Naproxen glucuronide ((S)-Naproxen-β-D-glucuronide) is a non-selective COX inhibitor. Naproxen glucuronide, a metabolite of naproxen, is a nonsteroidal anti-inflammatory drug (NSAID) of the propionic acid class (the same as ibuprofen) that relieves pain, fever, swelling, and stiffness[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Naproxen glucuronide | Naproxen glucuronide ((S)-Naproxen-β-D-glucuronide) is a non-selective COX inhibitor. Naproxen glucuronide, a metabolite of naproxen, is a nonsteroidal anti-inflammatory drug (NSAID) of the propionic acid class (the same as ibuprofen) that relieves pain, fever, swelling, and stiffness. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||