480439-84-7
Chemical Structure
Lucialdehyde B
- CAS No.: 480439-84-7
- Formula:C30H44O3
- Molecular Weight:452.67
IUPAC Name: (R,E)-2-methyl-6-((5R,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-3,7-dioxo-2,3,4,5,6,7,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)hept-2-enal
InChIKey: KZOBOICRKKYGAQ-GOUGDUPLSA-N
SMILES: C[C@]12C3=C(CC[C@@]1([C@@](CC2)([H])[C@H](C)CC/C=C(C)/C=O)C)[C@@]4([C@@](C(C)(C(CC4)=O)C)([H])CC3=O)C
Biological Activity: Lucialdehyde B is a tetracyclic triterpene isolated from the substrates of Ganoderma lucidum with antiviral and cytotoxic activities. Lucialdehyde B has cytotoxic effects against Lewis lung cancer (LLC), T-47D, Sarcoma 180 and Meth-A tumor cell lines[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Lucialdehyde B | Lucialdehyde B is a tetracyclic triterpene isolated from the substrates of Ganoderma lucidum with antiviral and cytotoxic activities. Lucialdehyde B has cytotoxic effects against Lewis lung cancer (LLC), T-47D, Sarcoma 180 and Meth-A tumor cell lines. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
