505-32-8
Chemical Structure
Isophytol
Synonym(s): Isovegetable alcohol
- CAS No.: 505-32-8
- Formula:C20H40O
- Molecular Weight:296.53
IUPAC Name: 3,7,11,15-tetramethylhexadec-1-en-3-ol
InChIKey: KEVYVLWNCKMXJX-UHFFFAOYSA-N
SMILES: OC(C=C)(C)CCCC(C)CCCC(C)CCCC(C)C
Biological Activity: Isophytol is a diterpene alcohol commonly found in various plant species, especially in chloroplasts, where it plays a role in photosynthesis. Isophytols have unique chemical properties that make them important ingredients in a variety of industrial processes, including the production of perfumes, essences and cosmetics. It also has potential medicinal properties, including antioxidant and anti-inflammatory effects.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Isophytol | 99.65% | Isophytol is a diterpene alcohol commonly found in various plant species, especially in chloroplasts, where it plays a role in photosynthesis. Isophytols have unique chemical properties that make them important ingredients in a variety of industrial processes, including the production of perfumes, essences and cosmetics. It also has potential medicinal properties, including antioxidant and anti-inflammatory effects. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||