56-37-1
Chemical Structure
Benzyltriethylammonium chloride
- CAS No.: 56-37-1
- Formula:C13H22ClN
- Molecular Weight:227.77
IUPAC Name: N-benzyl-N,N-diethylethanaminium chloride
InChIKey: HTZCNXWZYVXIMZ-UHFFFAOYSA-M
SMILES: CC[N+](CC)(CC)CC1=CC=CC=C1.[Cl-]
Biological Activity: Benzyltriethylammonium chloride is a quaternary ammonium salt commonly used as a phase transfer catalyst, surfactant and stabilizer in various chemical reactions, especially in organic synthesis. Benzyltriethylammonium chloride has unique chemical properties that facilitate the transfer of ions or molecules from one phase to another, making it an important ingredient in a variety of industrial processes.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Benzyltriethylammonium chloride | 99.90% | Benzyltriethylammonium chloride is a quaternary ammonium salt commonly used as a phase transfer catalyst, surfactant and stabilizer in various chemical reactions, especially in organic synthesis. Benzyltriethylammonium chloride has unique chemical properties that facilitate the transfer of ions or molecules from one phase to another, making it an important ingredient in a variety of industrial processes. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||