5678-45-5
Chemical Structure
3-Amino-3-(4-methoxyphenyl)propanoic acid
- CAS No.: 5678-45-5
- Formula:C10H13NO3
- Molecular Weight:195.22
IUPAC Name: 3-amino-3-(4-methoxyphenyl)propanoic acid
InChIKey: NYTANCDDCQVQHG-UHFFFAOYSA-N
SMILES: O=C(O)CC(N)C1=CC=C(OC)C=C1
Biological Activity: 3-Amino-3-(4-methoxyphenyl)propanoic acid is a β-amino acid. 3-Amino-3-(4-methoxyphenyl)propanoic acid can be stereoselectively synthesized using alanine as an amino donor and 3-(4-methoxyphenyl)3-oxopropanoic acid as an amino acceptor with a β-amino acid transaminase. 3-Amino-3-(4-methoxyphenyl)propanoic acid can be enantiomerically enriched from a racemic mixture using pyruvic acid as an amino acceptor with a β-amino acid transaminase. 3-Amino-3-(4-methoxyphenyl)propanoic acid can be used for research of bacterial and fungal infections[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
3-Amino-3-(4-methoxyphenyl)propanoic acid | 3-Amino-3-(4-methoxyphenyl)propanoic acid is a β-amino acid. 3-Amino-3-(4-methoxyphenyl)propanoic acid can be stereoselectively synthesized using alanine as an amino donor and 3-(4-methoxyphenyl)3-oxopropanoic acid as an amino acceptor with a β-amino acid transaminase. 3-Amino-3-(4-methoxyphenyl)propanoic acid can be enantiomerically enriched from a racemic mixture using pyruvic acid as an amino acceptor with a β-amino acid transaminase. 3-Amino-3-(4-methoxyphenyl)propanoic acid can be used for research of bacterial and fungal infections. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
