56857-57-9
Chemical Structure
Luteolin 7-sulfate
- CAS No.: 56857-57-9
- Formula:C15H10O9S
- Molecular Weight:366.30
IUPAC Name: 2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-4H-chromen-7-yl hydrogen sulfate
InChIKey: NTLSJCCPWSJISD-UHFFFAOYSA-N
SMILES: O=C1C2=C(O)C=C(OS(=O)(O)=O)C=C2OC(C3=CC(O)=C(O)C=C3)=C1
Biological Activity: Luteolin 7-sulfate is isolated from Phyllospadix iwatensis Makino, a marine plant. Luteolin 7-sulfate attenuates TYR gene expression through the intervention of a cAMP-responsive element binding protein (CREB)- and microphthalmia-associated transcription factor (MITF)-mediated signaling pathway, leading to the decreased melanin synthesis[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Luteolin 7-sulfate | 90.0% | Luteolin 7-sulfate is isolated from Phyllospadix iwatensis Makino, a marine plant. Luteolin 7-sulfate attenuates TYR gene expression through the intervention of a cAMP-responsive element binding protein (CREB)- and microphthalmia-associated transcription factor (MITF)-mediated signaling pathway, leading to the decreased melanin synthesis. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
