57105-48-3
57105-48-3
Chemical Structure
Indole-3-acetyl glutamate
Synonym(s): IAGlu
- CAS No.: 57105-48-3
- Formula:C15H16N2O5
- Molecular Weight:304.30
IUPAC Name: (2-(1H-indol-3-yl)acetyl)-L-glutamic acid
InChIKey: YRKLGWOHYXIKSF-LBPRGKRZSA-N
SMILES: OC(CC[C@@H](C(O)=O)NC(CC1=CNC2=CC=CC=C12)=O)=O
Biological Activity: Indole-3-acetyl glutamate (IAGlu) is a derivative of the plant hormone indole-3-acetic acid (IAA). As a conjugated form of IAA, Indole-3-acetyl glutamate involves in the transport, storage, and homeostatic regulation of IAA within the plant. Indole-3-acetyl glutamate can be used for research into the effects of plant hormones on the growth and development of plants[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Indole-3-acetyl glutamate | 99.77% | Indole-3-acetyl glutamate (IAGlu) is a derivative of the plant hormone indole-3-acetic acid (IAA). As a conjugated form of IAA, Indole-3-acetyl glutamate involves in the transport, storage, and homeostatic regulation of IAA within the plant. Indole-3-acetyl glutamate can be used for research into the effects of plant hormones on the growth and development of plants. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Indole-3-acetyl glutamate-d4 | Indole-3-acetyl glutamate-d4 (IAGlu-d4) is deuterium labeled Indole-3-acetyl glutamate. Indole-3-acetyl glutamate (IAGlu) is a derivative of the plant hormone indole-3-acetic acid (IAA). As a conjugated form of IAA, Indole-3-acetyl glutamate involves in the transport, storage, and homeostatic regulation of IAA within the plant. Indole-3-acetyl glutamate can be used for research into the effects of plant hormones on the growth and development of plants. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
