653600-56-7
Chemical Structure
Ac4GalNAz
- CAS No.: 653600-56-7
- Formula:C16H22N4O10
- Molecular Weight:430.37
IUPAC Name: (3R,4R,5R,6R)-6-(acetoxymethyl)-3-(2-azidoacetamido)tetrahydro-2H-pyran-2,4,5-triyl triacetate
InChIKey: HGMISDAXLUIXKM-YJUJGKJLSA-N
SMILES: O=C(N[C@H]1C(OC(C)=O)O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O)CN=[N+]=[N-]
Biological Activity: Ac4GalNAz is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Ac4GalNAz is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Ac4GalNAz | 99.99% | Ac4GalNAz is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs. Ac4GalNAz is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||