67259-16-9
Chemical Structure
Moracin B
- CAS No.: 67259-16-9
- Formula:C16H14O5
- Molecular Weight:286.28
InChIKey: GOUSNRMGQRTROZ-UHFFFAOYSA-N
SMILES: OC1=C(OC)C=C(OC(C2=CC(OC)=CC(O)=C2)=C3)C3=C1
Biological Activity: Moracin B is a phytoalexin with antifungal activity. Moracin B can be isolated from the cortex and phloem tissues of mulberry (Morus alba Linne) infected with Fusarium solani f. sp. mori. Moracin B can be used to study plant disease resistance mechanisms against microbial infections, particularly showing potential application value in the field of plant disease control[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Moracin B | Moracin B is a phytoalexin with antifungal activity. Moracin B can be isolated from the cortex and phloem tissues of mulberry (Morus alba Linne) infected with Fusarium solani f. sp. mori. Moracin B can be used to study plant disease resistance mechanisms against microbial infections, particularly showing potential application value in the field of plant disease control. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords