678173-92-7
Chemical Structure
(S)-4-(3-Thienyl)phenyl-α-methylacetic acid
- CAS No.: 678173-92-7
- Formula:C13H12O2S
- Molecular Weight:232.30
IUPAC Name: (S)-2-(4-(thiophen-3-yl)phenyl)propanoic acid
InChIKey: PFLCZHOSQMPCMN-VIFPVBQESA-N
SMILES: [C@H](C(O)=O)(C)C1=CC=C(C=C1)C=2C=CSC2
Biological Activity: (S)-4-(3-Thienyl) phenyl-α-methylacetic acid is the S-enantiomer of the racemate corresponding to 4-(3-Thienyl) phenyl-α-methylacetic acid. As a key synthetic precursor, 4-(3-Thienyl) phenyl-α-methylacetic acid is used to prepare the cyclooxygenase inhibitor S-Atliprofen[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
(S)-4-(3-Thienyl)phenyl-α-methylacetic acid | (S)-4-(3-Thienyl) phenyl-α-methylacetic acid is the S-enantiomer of the racemate corresponding to 4-(3-Thienyl) phenyl-α-methylacetic acid. As a key synthetic precursor, 4-(3-Thienyl) phenyl-α-methylacetic acid is used to prepare the cyclooxygenase inhibitor S-Atliprofen. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||